C29H32N4O3 — CID 21047698
N-(5-oxo-3-phenyl-1H-1,2,4-triazol-4-yl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide (PubChem CID 21047698) has the molecular formula C29H32N4O3 and a molecular weight of 484.60 g/mol. Its IUPAC name is N-(5-oxo-3-phenyl-1H-1,2,4-triazol-4-yl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide.
| Compound Name | N-(5-oxo-3-phenyl-1H-1,2,4-triazol-4-yl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21047698 |
| Molecular Formula | C29H32N4O3 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | N-(5-oxo-3-phenyl-1H-1,2,4-triazol-4-yl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)Nn3c(-c4ccccc4)n[nH]c3=O)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C29H32N4O3/c1-18-15-22-23(29(4,5)14-13-28(22,2)3)17-20(18)16-21-11-12-24(36-21)26(34)32-33-25(30-31-27(33)35)19-9-7-6-8-10-19/h6-12,15,17H,13-14,16H2,1-5H3,(H,31,35)(H,32,34) |
| InChIKey | RGIMDIZOGWVRKI-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 92.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |