C32H39NO3 — CID 21045697
(4-hydroxy-4-phenylpiperidin-1-yl)-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-yl]methanone (PubChem CID 21045697) has the molecular formula C32H39NO3 and a molecular weight of 485.67 g/mol. Its IUPAC name is (4-hydroxy-4-phenylpiperidin-1-yl)-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-yl]methanone.
| Compound Name | (4-hydroxy-4-phenylpiperidin-1-yl)-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-yl]methanone |
|---|---|
| PubChem CID | 21045697 |
| Molecular Formula | C32H39NO3 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.29 |
| IUPAC Name | (4-hydroxy-4-phenylpiperidin-1-yl)-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-yl]methanone |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)N3CCC(O)(c4ccccc4)CC3)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C32H39NO3/c1-22-19-26-27(31(4,5)14-13-30(26,2)3)21-23(22)20-25-11-12-28(36-25)29(34)33-17-15-32(35,16-18-33)24-9-7-6-8-10-24/h6-12,19,21,35H,13-18,20H2,1-5H3 |
| InChIKey | LGSIPBZAYFTBNW-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |