C34H41N3O3 — CID 21046344
8-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 21046344) has the molecular formula C34H41N3O3 and a molecular weight of 539.72 g/mol. Its IUPAC name is 8-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 8-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 21046344 |
| Molecular Formula | C34H41N3O3 |
| Molecular Weight | 539.72 g/mol |
| Exact Mass | 539.31 |
| IUPAC Name | 8-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)N3CCC4(CC3)C(=O)NCN4c3ccccc3)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C34H41N3O3/c1-23-19-27-28(33(4,5)14-13-32(27,2)3)21-24(23)20-26-11-12-29(40-26)30(38)36-17-15-34(16-18-36)31(39)35-22-37(34)25-9-7-6-8-10-25/h6-12,19,21H,13-18,20,22H2,1-5H3,(H,35,39) |
| InChIKey | MJEPTNCBCBQBIP-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.72 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |