C27H36N2O3 — CID 21046750
N-[1-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]pyrrolidin-3-yl]acetamide (PubChem CID 21046750) has the molecular formula C27H36N2O3 and a molecular weight of 436.60 g/mol. Its IUPAC name is N-[1-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]pyrrolidin-3-yl]acetamide.
| Compound Name | N-[1-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 21046750 |
| Molecular Formula | C27H36N2O3 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | N-[1-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]pyrrolidin-3-yl]acetamide |
| SMILES | CC(=O)NC1CCN(C(=O)c2ccc(Cc3cc4c(cc3C)C(C)(C)CCC4(C)C)o2)C1 |
| InChI | InChI=1S/C27H36N2O3/c1-17-13-22-23(27(5,6)11-10-26(22,3)4)15-19(17)14-21-7-8-24(32-21)25(31)29-12-9-20(16-29)28-18(2)30/h7-8,13,15,20H,9-12,14,16H2,1-6H3,(H,28,30) |
| InChIKey | BRBRPHSPWAVMIY-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |