C28H39NO3 — CID 58696848
N-[[(1S,2R)-2-hydroxycyclohexyl]methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide (PubChem CID 58696848) has the molecular formula C28H39NO3 and a molecular weight of 437.62 g/mol. Its IUPAC name is N-[[(1S,2R)-2-hydroxycyclohexyl]methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[[(1S,2R)-2-hydroxycyclohexyl]methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 58696848 |
| Molecular Formula | C28H39NO3 |
| Molecular Weight | 437.62 g/mol |
| Exact Mass | 437.29 |
| IUPAC Name | N-[[(1S,2R)-2-hydroxycyclohexyl]methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)NC[C@@H]3CCCC[C@H]3O)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C28H39NO3/c1-18-14-22-23(28(4,5)13-12-27(22,2)3)16-20(18)15-21-10-11-25(32-21)26(31)29-17-19-8-6-7-9-24(19)30/h10-11,14,16,19,24,30H,6-9,12-13,15,17H2,1-5H3,(H,29,31)/t19-,24+/m0/s1 |
| InChIKey | WURQTKHDJIGKQC-YADARESESA-N |
| XLogP | 5.81 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.62 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |