C31H38N2O3 — CID 21048047
N-(4-morpholin-4-ylphenyl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide (PubChem CID 21048047) has the molecular formula C31H38N2O3 and a molecular weight of 486.66 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide.
| Compound Name | N-(4-morpholin-4-ylphenyl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21048047 |
| Molecular Formula | C31H38N2O3 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.29 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)Nc3ccc(N4CCOCC4)cc3)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C31H38N2O3/c1-21-18-26-27(31(4,5)13-12-30(26,2)3)20-22(21)19-25-10-11-28(36-25)29(34)32-23-6-8-24(9-7-23)33-14-16-35-17-15-33/h6-11,18,20H,12-17,19H2,1-5H3,(H,32,34) |
| InChIKey | QYVKMMXGJGZWKR-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|