C29H39NO4 — CID 21046343
1,5-dioxa-9-azaspiro[5.5]undecan-9-yl-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-yl]methanone (PubChem CID 21046343) has the molecular formula C29H39NO4 and a molecular weight of 465.63 g/mol. Its IUPAC name is 1,5-dioxa-9-azaspiro[5.5]undecan-9-yl-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-yl]methanone.
| Compound Name | 1,5-dioxa-9-azaspiro[5.5]undecan-9-yl-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-yl]methanone |
|---|---|
| PubChem CID | 21046343 |
| Molecular Formula | C29H39NO4 |
| Molecular Weight | 465.63 g/mol |
| Exact Mass | 465.29 |
| IUPAC Name | 1,5-dioxa-9-azaspiro[5.5]undecan-9-yl-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-yl]methanone |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)N3CCC4(CC3)OCCCO4)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C29H39NO4/c1-20-17-23-24(28(4,5)10-9-27(23,2)3)19-21(20)18-22-7-8-25(34-22)26(31)30-13-11-29(12-14-30)32-15-6-16-33-29/h7-8,17,19H,6,9-16,18H2,1-5H3 |
| InChIKey | YRIHSEVAPITHRE-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.63 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |