C27H37NO2 — CID 21045568
(3-methylpiperidin-1-yl)-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-yl]methanone (PubChem CID 21045568) has the molecular formula C27H37NO2 and a molecular weight of 407.60 g/mol. Its IUPAC name is (3-methylpiperidin-1-yl)-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-yl]methanone.
| Compound Name | (3-methylpiperidin-1-yl)-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-yl]methanone |
|---|---|
| PubChem CID | 21045568 |
| Molecular Formula | C27H37NO2 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | (3-methylpiperidin-1-yl)-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-yl]methanone |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)N3CCCC(C)C3)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C27H37NO2/c1-18-8-7-13-28(17-18)25(29)24-10-9-21(30-24)15-20-16-23-22(14-19(20)2)26(3,4)11-12-27(23,5)6/h9-10,14,16,18H,7-8,11-13,15,17H2,1-6H3 |
| InChIKey | SNBGRDAWAIHTMY-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |