C39H46N2O3 — CID 21046778
N-(1-benzylpyrrolidin-3-yl)-N-[(4-hydroxyphenyl)methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide (PubChem CID 21046778) has the molecular formula C39H46N2O3 and a molecular weight of 590.81 g/mol. Its IUPAC name is N-(1-benzylpyrrolidin-3-yl)-N-[(4-hydroxyphenyl)methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide.
| Compound Name | N-(1-benzylpyrrolidin-3-yl)-N-[(4-hydroxyphenyl)methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21046778 |
| Molecular Formula | C39H46N2O3 |
| Molecular Weight | 590.81 g/mol |
| Exact Mass | 590.35 |
| IUPAC Name | N-(1-benzylpyrrolidin-3-yl)-N-[(4-hydroxyphenyl)methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)N(Cc3ccc(O)cc3)C3CCN(Cc4ccccc4)C3)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C39H46N2O3/c1-27-21-34-35(39(4,5)19-18-38(34,2)3)23-30(27)22-33-15-16-36(44-33)37(43)41(25-29-11-13-32(42)14-12-29)31-17-20-40(26-31)24-28-9-7-6-8-10-28/h6-16,21,23,31,42H,17-20,22,24-26H2,1-5H3 |
| InChIKey | PWSZCGWLIGAYKO-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.81 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |