C36H47Cl2N3O2 — CID 21047542
N-[(3,4-dichlorophenyl)methyl]-N-[3-(4-methylpiperazin-1-yl)propyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide (PubChem CID 21047542) has the molecular formula C36H47Cl2N3O2 and a molecular weight of 624.70 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-N-[3-(4-methylpiperazin-1-yl)propyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-N-[3-(4-methylpiperazin-1-yl)propyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21047542 |
| Molecular Formula | C36H47Cl2N3O2 |
| Molecular Weight | 624.70 g/mol |
| Exact Mass | 623.30 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-N-[3-(4-methylpiperazin-1-yl)propyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)N(CCCN3CCN(C)CC3)Cc3ccc(Cl)c(Cl)c3)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C36H47Cl2N3O2/c1-25-20-29-30(36(4,5)13-12-35(29,2)3)23-27(25)22-28-9-11-33(43-28)34(42)41(24-26-8-10-31(37)32(38)21-26)15-7-14-40-18-16-39(6)17-19-40/h8-11,20-21,23H,7,12-19,22,24H2,1-6H3 |
| InChIKey | PDIPGDIPJAKAOR-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 39.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.70 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |