C31H38N2O4 — CID 21046511
ethyl 2-[[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]-(pyridin-2-ylmethyl)amino]acetate (PubChem CID 21046511) has the molecular formula C31H38N2O4 and a molecular weight of 502.66 g/mol. Its IUPAC name is ethyl 2-[[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]-(pyridin-2-ylmethyl)amino]acetate.
| Compound Name | ethyl 2-[[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]-(pyridin-2-ylmethyl)amino]acetate |
|---|---|
| PubChem CID | 21046511 |
| Molecular Formula | C31H38N2O4 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | ethyl 2-[[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]-(pyridin-2-ylmethyl)amino]acetate |
| SMILES | CCOC(=O)CN(Cc1ccccn1)C(=O)c1ccc(Cc2cc3c(cc2C)C(C)(C)CCC3(C)C)o1 |
| InChI | InChI=1S/C31H38N2O4/c1-7-36-28(34)20-33(19-23-10-8-9-15-32-23)29(35)27-12-11-24(37-27)17-22-18-26-25(16-21(22)2)30(3,4)13-14-31(26,5)6/h8-12,15-16,18H,7,13-14,17,19-20H2,1-6H3 |
| InChIKey | NCCAOTZJSBLZRV-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |