C32H39NO4 — CID 21046510
ethyl 2-[benzyl-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]amino]acetate (PubChem CID 21046510) has the molecular formula C32H39NO4 and a molecular weight of 501.67 g/mol. Its IUPAC name is ethyl 2-[benzyl-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]amino]acetate.
| Compound Name | ethyl 2-[benzyl-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 21046510 |
| Molecular Formula | C32H39NO4 |
| Molecular Weight | 501.67 g/mol |
| Exact Mass | 501.29 |
| IUPAC Name | ethyl 2-[benzyl-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]amino]acetate |
| SMILES | CCOC(=O)CN(Cc1ccccc1)C(=O)c1ccc(Cc2cc3c(cc2C)C(C)(C)CCC3(C)C)o1 |
| InChI | InChI=1S/C32H39NO4/c1-7-36-29(34)21-33(20-23-11-9-8-10-12-23)30(35)28-14-13-25(37-28)18-24-19-27-26(17-22(24)2)31(3,4)15-16-32(27,5)6/h8-14,17,19H,7,15-16,18,20-21H2,1-6H3 |
| InChIKey | JFAYMFHHGDEDHZ-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.67 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |