C36H41NO2 — CID 58696882
N-benzyl-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-[(1S)-1-phenylethyl]furan-2-carboxamide (PubChem CID 58696882) has the molecular formula C36H41NO2 and a molecular weight of 519.73 g/mol. Its IUPAC name is N-benzyl-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-[(1S)-1-phenylethyl]furan-2-carboxamide.
| Compound Name | N-benzyl-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-[(1S)-1-phenylethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 58696882 |
| Molecular Formula | C36H41NO2 |
| Molecular Weight | 519.73 g/mol |
| Exact Mass | 519.31 |
| IUPAC Name | N-benzyl-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-[(1S)-1-phenylethyl]furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)N(Cc3ccccc3)[C@@H](C)c3ccccc3)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C36H41NO2/c1-25-21-31-32(36(5,6)20-19-35(31,3)4)23-29(25)22-30-17-18-33(39-30)34(38)37(24-27-13-9-7-10-14-27)26(2)28-15-11-8-12-16-28/h7-18,21,23,26H,19-20,22,24H2,1-6H3/t26-/m0/s1 |
| InChIKey | WVHCIVBHHLGRIF-SANMLTNESA-N |
| XLogP | 8.93 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.73 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |