C35H38N2O3 — CID 21047255
N-[2-(benzylcarbamoyl)phenyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide (PubChem CID 21047255) has the molecular formula C35H38N2O3 and a molecular weight of 534.70 g/mol. Its IUPAC name is N-[2-(benzylcarbamoyl)phenyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[2-(benzylcarbamoyl)phenyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21047255 |
| Molecular Formula | C35H38N2O3 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.29 |
| IUPAC Name | N-[2-(benzylcarbamoyl)phenyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)Nc3ccccc3C(=O)NCc3ccccc3)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C35H38N2O3/c1-23-19-28-29(35(4,5)18-17-34(28,2)3)21-25(23)20-26-15-16-31(40-26)33(39)37-30-14-10-9-13-27(30)32(38)36-22-24-11-7-6-8-12-24/h6-16,19,21H,17-18,20,22H2,1-5H3,(H,36,38)(H,37,39) |
| InChIKey | SPKQQSYPEIRPTR-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |