C48H55NO6 — CID 21045565
[3-hydroxy-2-[[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]amino]phenyl] 5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxylate (PubChem CID 21045565) has the molecular formula C48H55NO6 and a molecular weight of 741.97 g/mol. Its IUPAC name is [3-hydroxy-2-[[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]amino]phenyl] 5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxylate.
| Compound Name | [3-hydroxy-2-[[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]amino]phenyl] 5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 21045565 |
| Molecular Formula | C48H55NO6 |
| Molecular Weight | 741.97 g/mol |
| Exact Mass | 741.40 |
| IUPAC Name | [3-hydroxy-2-[[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]amino]phenyl] 5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxylate |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)Nc3c(O)cccc3OC(=O)c3ccc(Cc4cc5c(cc4C)C(C)(C)CCC5(C)C)o3)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C48H55NO6/c1-28-22-34-36(47(7,8)20-18-45(34,3)4)26-30(28)24-32-14-16-40(53-32)43(51)49-42-38(50)12-11-13-39(42)55-44(52)41-17-15-33(54-41)25-31-27-37-35(23-29(31)2)46(5,6)19-21-48(37,9)10/h11-17,22-23,26-27,50H,18-21,24-25H2,1-10H3,(H,49,51) |
| InChIKey | DQPCKVAXBFWCMM-UHFFFAOYSA-N |
| XLogP | 11.55 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.97 |
| LogP ≤ 5 | 11.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|