C29H35NO5S — CID 21048123
N-(5-ethylsulfonyl-2-hydroxyphenyl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide (PubChem CID 21048123) has the molecular formula C29H35NO5S and a molecular weight of 509.67 g/mol. Its IUPAC name is N-(5-ethylsulfonyl-2-hydroxyphenyl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide.
| Compound Name | N-(5-ethylsulfonyl-2-hydroxyphenyl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21048123 |
| Molecular Formula | C29H35NO5S |
| Molecular Weight | 509.67 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | N-(5-ethylsulfonyl-2-hydroxyphenyl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc(O)c(NC(=O)c2ccc(Cc3cc4c(cc3C)C(C)(C)CCC4(C)C)o2)c1 |
| InChI | InChI=1S/C29H35NO5S/c1-7-36(33,34)21-9-10-25(31)24(17-21)30-27(32)26-11-8-20(35-26)15-19-16-23-22(14-18(19)2)28(3,4)12-13-29(23,5)6/h8-11,14,16-17,31H,7,12-13,15H2,1-6H3,(H,30,32) |
| InChIKey | PRDCEMCOEVMGLR-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.67 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|