C29H33N3O8 — CID 21047595
N-(3,5-dimethoxy-2,6-dinitrophenyl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide (PubChem CID 21047595) has the molecular formula C29H33N3O8 and a molecular weight of 551.60 g/mol. Its IUPAC name is N-(3,5-dimethoxy-2,6-dinitrophenyl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide.
| Compound Name | N-(3,5-dimethoxy-2,6-dinitrophenyl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21047595 |
| Molecular Formula | C29H33N3O8 |
| Molecular Weight | 551.60 g/mol |
| Exact Mass | 551.23 |
| IUPAC Name | N-(3,5-dimethoxy-2,6-dinitrophenyl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
| SMILES | COc1cc(OC)c([N+](=O)[O-])c(NC(=O)c2ccc(Cc3cc4c(cc3C)C(C)(C)CCC4(C)C)o2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C29H33N3O8/c1-16-12-19-20(29(4,5)11-10-28(19,2)3)14-17(16)13-18-8-9-21(40-18)27(33)30-24-25(31(34)35)22(38-6)15-23(39-7)26(24)32(36)37/h8-9,12,14-15H,10-11,13H2,1-7H3,(H,30,33) |
| InChIKey | NSJHNWVYKQGKID-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 146.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.60 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|