C31H37NO8 — CID 21046556
methyl 3-hydroperoxy-4,5-dimethoxy-2-[[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]amino]benzoate (PubChem CID 21046556) has the molecular formula C31H37NO8 and a molecular weight of 551.64 g/mol. Its IUPAC name is methyl 3-hydroperoxy-4,5-dimethoxy-2-[[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]amino]benzoate.
| Compound Name | methyl 3-hydroperoxy-4,5-dimethoxy-2-[[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 21046556 |
| Molecular Formula | C31H37NO8 |
| Molecular Weight | 551.64 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | methyl 3-hydroperoxy-4,5-dimethoxy-2-[[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1cc(OC)c(OC)c(OO)c1NC(=O)c1ccc(Cc2cc3c(cc2C)C(C)(C)CCC3(C)C)o1 |
| InChI | InChI=1S/C31H37NO8/c1-17-13-21-22(31(4,5)12-11-30(21,2)3)15-18(17)14-19-9-10-23(39-19)28(33)32-25-20(29(34)38-8)16-24(36-6)26(37-7)27(25)40-35/h9-10,13,15-16,35H,11-12,14H2,1-8H3,(H,32,33) |
| InChIKey | BGFSUKSTFONMBE-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 116.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.64 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|