C30H36BrNO3 — CID 21047063
N-[2-(3-bromo-4-methoxyphenyl)ethyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide (PubChem CID 21047063) has the molecular formula C30H36BrNO3 and a molecular weight of 538.53 g/mol. Its IUPAC name is N-[2-(3-bromo-4-methoxyphenyl)ethyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[2-(3-bromo-4-methoxyphenyl)ethyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21047063 |
| Molecular Formula | C30H36BrNO3 |
| Molecular Weight | 538.53 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | N-[2-(3-bromo-4-methoxyphenyl)ethyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
| SMILES | COc1ccc(CCNC(=O)c2ccc(Cc3cc4c(cc3C)C(C)(C)CCC4(C)C)o2)cc1Br |
| InChI | InChI=1S/C30H36BrNO3/c1-19-15-23-24(30(4,5)13-12-29(23,2)3)18-21(19)17-22-8-10-27(35-22)28(33)32-14-11-20-7-9-26(34-6)25(31)16-20/h7-10,15-16,18H,11-14,17H2,1-6H3,(H,32,33) |
| InChIKey | UQRWZHIUUAFUDD-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.53 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |