C30H37NO3 — CID 21046764
N-(1-hydroxy-3-phenylpropan-2-yl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide (PubChem CID 21046764) has the molecular formula C30H37NO3 and a molecular weight of 459.63 g/mol. Its IUPAC name is N-(1-hydroxy-3-phenylpropan-2-yl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide.
| Compound Name | N-(1-hydroxy-3-phenylpropan-2-yl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21046764 |
| Molecular Formula | C30H37NO3 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | N-(1-hydroxy-3-phenylpropan-2-yl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)NC(CO)Cc3ccccc3)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C30H37NO3/c1-20-15-25-26(30(4,5)14-13-29(25,2)3)18-22(20)17-24-11-12-27(34-24)28(33)31-23(19-32)16-21-9-7-6-8-10-21/h6-12,15,18,23,32H,13-14,16-17,19H2,1-5H3,(H,31,33) |
| InChIKey | ABDKATPTZYUNGK-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |