C28H32ClNO2 — CID 21047293
N-[(2-chlorophenyl)methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide (PubChem CID 21047293) has the molecular formula C28H32ClNO2 and a molecular weight of 450.02 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21047293 |
| Molecular Formula | C28H32ClNO2 |
| Molecular Weight | 450.02 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)NCc3ccccc3Cl)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C28H32ClNO2/c1-18-14-22-23(28(4,5)13-12-27(22,2)3)16-20(18)15-21-10-11-25(32-21)26(31)30-17-19-8-6-7-9-24(19)29/h6-11,14,16H,12-13,15,17H2,1-5H3,(H,30,31) |
| InChIKey | TYIOHNJRGJTAMP-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.02 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |