C34H44N2O3 — CID 21048292
N-benzyl-N-(2-morpholin-4-ylethyl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide (PubChem CID 21048292) has the molecular formula C34H44N2O3 and a molecular weight of 528.74 g/mol. Its IUPAC name is N-benzyl-N-(2-morpholin-4-ylethyl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide.
| Compound Name | N-benzyl-N-(2-morpholin-4-ylethyl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21048292 |
| Molecular Formula | C34H44N2O3 |
| Molecular Weight | 528.74 g/mol |
| Exact Mass | 528.34 |
| IUPAC Name | N-benzyl-N-(2-morpholin-4-ylethyl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)N(CCN3CCOCC3)Cc3ccccc3)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C34H44N2O3/c1-25-21-29-30(34(4,5)14-13-33(29,2)3)23-27(25)22-28-11-12-31(39-28)32(37)36(24-26-9-7-6-8-10-26)16-15-35-17-19-38-20-18-35/h6-12,21,23H,13-20,22,24H2,1-5H3 |
| InChIKey | VRXFZVZFBXVEPQ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.74 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |