C41H47F3N2O3 — CID 21045786
5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-(2-pyrrolidin-1-ylethyl)-N-[[3-[3-(trifluoromethyl)phenoxy]phenyl]methyl]furan-2-carboxamide (PubChem CID 21045786) has the molecular formula C41H47F3N2O3 and a molecular weight of 672.83 g/mol. Its IUPAC name is 5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-(2-pyrrolidin-1-ylethyl)-N-[[3-[3-(trifluoromethyl)phenoxy]phenyl]methyl]furan-2-carboxamide.
| Compound Name | 5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-(2-pyrrolidin-1-ylethyl)-N-[[3-[3-(trifluoromethyl)phenoxy]phenyl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21045786 |
| Molecular Formula | C41H47F3N2O3 |
| Molecular Weight | 672.83 g/mol |
| Exact Mass | 672.35 |
| IUPAC Name | 5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]-N-(2-pyrrolidin-1-ylethyl)-N-[[3-[3-(trifluoromethyl)phenoxy]phenyl]methyl]furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)N(CCN3CCCC3)Cc3cccc(Oc4cccc(C(F)(F)F)c4)c3)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C41H47F3N2O3/c1-28-22-35-36(40(4,5)17-16-39(35,2)3)25-30(28)24-34-14-15-37(49-34)38(47)46(21-20-45-18-6-7-19-45)27-29-10-8-12-32(23-29)48-33-13-9-11-31(26-33)41(42,43)44/h8-15,22-23,25-26H,6-7,16-21,24,27H2,1-5H3 |
| InChIKey | YYCDSSSRPYNKOW-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.83 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |