C26H34N2O3 — CID 58696940
(2S)-1-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]pyrrolidine-2-carboxamide (PubChem CID 58696940) has the molecular formula C26H34N2O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is (2S)-1-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 58696940 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | (2S)-1-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]pyrrolidine-2-carboxamide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)N3CCC[C@H]3C(N)=O)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C26H34N2O3/c1-16-13-19-20(26(4,5)11-10-25(19,2)3)15-17(16)14-18-8-9-22(31-18)24(30)28-12-6-7-21(28)23(27)29/h8-9,13,15,21H,6-7,10-12,14H2,1-5H3,(H2,27,29)/t21-/m0/s1 |
| InChIKey | HPSOOSHIGLHTHZ-NRFANRHFSA-N |
| XLogP | 4.62 |
| TPSA | 76.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |