C35H50N2O3 — CID 21045532
N-tert-butyl-2-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide (PubChem CID 21045532) has the molecular formula C35H50N2O3 and a molecular weight of 546.80 g/mol. Its IUPAC name is N-tert-butyl-2-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide.
| Compound Name | N-tert-butyl-2-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 21045532 |
| Molecular Formula | C35H50N2O3 |
| Molecular Weight | 546.80 g/mol |
| Exact Mass | 546.38 |
| IUPAC Name | N-tert-butyl-2-[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxamide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)N3CC4CCCCC4CC3C(=O)NC(C)(C)C)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C35H50N2O3/c1-22-17-27-28(35(7,8)16-15-34(27,5)6)19-25(22)18-26-13-14-30(40-26)32(39)37-21-24-12-10-9-11-23(24)20-29(37)31(38)36-33(2,3)4/h13-14,17,19,23-24,29H,9-12,15-16,18,20-21H2,1-8H3,(H,36,38) |
| InChIKey | UQHYJRPHRLULQI-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.80 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |