C30H42N2O4 — CID 21048458
tert-butyl 3-[[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]amino]pyrrolidine-1-carboxylate (PubChem CID 21048458) has the molecular formula C30H42N2O4 and a molecular weight of 494.68 g/mol. Its IUPAC name is tert-butyl 3-[[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 21048458 |
| Molecular Formula | C30H42N2O4 |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.31 |
| IUPAC Name | tert-butyl 3-[[5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carbonyl]amino]pyrrolidine-1-carboxylate |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)NC3CCN(C(=O)OC(C)(C)C)C3)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C30H42N2O4/c1-19-15-23-24(30(7,8)13-12-29(23,5)6)17-20(19)16-22-9-10-25(35-22)26(33)31-21-11-14-32(18-21)27(34)36-28(2,3)4/h9-10,15,17,21H,11-14,16,18H2,1-8H3,(H,31,33) |
| InChIKey | SBYIXTZAGLFFGG-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |