C35H37N3O2 — CID 21046769
N-(1-benzylbenzimidazol-2-yl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide (PubChem CID 21046769) has the molecular formula C35H37N3O2 and a molecular weight of 531.70 g/mol. Its IUPAC name is N-(1-benzylbenzimidazol-2-yl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide.
| Compound Name | N-(1-benzylbenzimidazol-2-yl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21046769 |
| Molecular Formula | C35H37N3O2 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.29 |
| IUPAC Name | N-(1-benzylbenzimidazol-2-yl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)Nc3nc4ccccc4n3Cc3ccccc3)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C35H37N3O2/c1-23-19-27-28(35(4,5)18-17-34(27,2)3)21-25(23)20-26-15-16-31(40-26)32(39)37-33-36-29-13-9-10-14-30(29)38(33)22-24-11-7-6-8-12-24/h6-16,19,21H,17-18,20,22H2,1-5H3,(H,36,37,39) |
| InChIKey | JTEREZPNZRWKGD-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |