C29H37NO5 — CID 21046413
ethyl 1-[5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)furan-2-carbonyl]piperidine-3-carboxylate (PubChem CID 21046413) has the molecular formula C29H37NO5 and a molecular weight of 479.62 g/mol. Its IUPAC name is ethyl 1-[5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)furan-2-carbonyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)furan-2-carbonyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 21046413 |
| Molecular Formula | C29H37NO5 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.27 |
| IUPAC Name | ethyl 1-[5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carbonyl)furan-2-carbonyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)c2ccc(C(=O)c3cc4c(cc3C)C(C)(C)CCC4(C)C)o2)C1 |
| InChI | InChI=1S/C29H37NO5/c1-7-34-27(33)19-9-8-14-30(17-19)26(32)24-11-10-23(35-24)25(31)20-16-22-21(15-18(20)2)28(3,4)12-13-29(22,5)6/h10-11,15-16,19H,7-9,12-14,17H2,1-6H3 |
| InChIKey | FEZAZLKGPGKLET-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |