C17H23NO3 — CID 81338523
ethyl (3R)-1-(2,4-dimethylbenzoyl)piperidine-3-carboxylate (PubChem CID 81338523) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is ethyl (3R)-1-(2,4-dimethylbenzoyl)piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-(2,4-dimethylbenzoyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 81338523 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | ethyl (3R)-1-(2,4-dimethylbenzoyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(C(=O)c2ccc(C)cc2C)C1 |
| InChI | InChI=1S/C17H23NO3/c1-4-21-17(20)14-6-5-9-18(11-14)16(19)15-8-7-12(2)10-13(15)3/h7-8,10,14H,4-6,9,11H2,1-3H3/t14-/m1/s1 |
| InChIKey | HRYNVYBZVAVUCK-CQSZACIVSA-N |
| XLogP | 2.72 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |