C27H36N3O2+ — CID 21047532
N-[3-(1H-imidazol-3-ium-3-yl)propyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide (PubChem CID 21047532) has the molecular formula C27H36N3O2+ and a molecular weight of 434.60 g/mol. Its IUPAC name is N-[3-(1H-imidazol-3-ium-3-yl)propyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[3-(1H-imidazol-3-ium-3-yl)propyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21047532 |
| Molecular Formula | C27H36N3O2+ |
| Molecular Weight | 434.60 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | N-[3-(1H-imidazol-3-ium-3-yl)propyl]-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-carboxamide |
| SMILES | Cc1cc2c(cc1Cc1ccc(C(=O)NCCC[n+]3cc[nH]c3)o1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C27H35N3O2/c1-19-15-22-23(27(4,5)10-9-26(22,2)3)17-20(19)16-21-7-8-24(32-21)25(31)29-11-6-13-30-14-12-28-18-30/h7-8,12,14-15,17-18H,6,9-11,13,16H2,1-5H3,(H,29,31)/p+1 |
| InChIKey | RZDZIWPEHTWJOY-UHFFFAOYSA-O |
| XLogP | 4.96 |
| TPSA | 61.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|