C27H25FN2O2 — CID 5110076
5-[[benzyl-[(4-methylphenyl)methyl]amino]methyl]-N-(4-fluorophenyl)furan-2-carboxamide (PubChem CID 5110076) has the molecular formula C27H25FN2O2 and a molecular weight of 428.51 g/mol. Its IUPAC name is 5-[[benzyl-[(4-methylphenyl)methyl]amino]methyl]-N-(4-fluorophenyl)furan-2-carboxamide.
| Compound Name | 5-[[benzyl-[(4-methylphenyl)methyl]amino]methyl]-N-(4-fluorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 5110076 |
| Molecular Formula | C27H25FN2O2 |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 5-[[benzyl-[(4-methylphenyl)methyl]amino]methyl]-N-(4-fluorophenyl)furan-2-carboxamide |
| SMILES | Cc1ccc(CN(Cc2ccccc2)Cc2ccc(C(=O)Nc3ccc(F)cc3)o2)cc1 |
| InChI | InChI=1S/C27H25FN2O2/c1-20-7-9-22(10-8-20)18-30(17-21-5-3-2-4-6-21)19-25-15-16-26(32-25)27(31)29-24-13-11-23(28)12-14-24/h2-16H,17-19H2,1H3,(H,29,31) |
| InChIKey | AYGYGCRDOLQZMK-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |