C13H18BrNO3S — CID 107007678
3-bromo-4-hept-6-enoxybenzenesulfonamide (PubChem CID 107007678) has the molecular formula C13H18BrNO3S and a molecular weight of 348.26 g/mol. Its IUPAC name is 3-bromo-4-hept-6-enoxybenzenesulfonamide.
| Compound Name | 3-bromo-4-hept-6-enoxybenzenesulfonamide |
|---|---|
| PubChem CID | 107007678 |
| Molecular Formula | C13H18BrNO3S |
| Molecular Weight | 348.26 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 3-bromo-4-hept-6-enoxybenzenesulfonamide |
| SMILES | C=CCCCCCOc1ccc(S(N)(=O)=O)cc1Br |
| InChI | InChI=1S/C13H18BrNO3S/c1-2-3-4-5-6-9-18-13-8-7-11(10-12(13)14)19(15,16)17/h2,7-8,10H,1,3-6,9H2,(H2,15,16,17) |
| InChIKey | HIEYJPTYMOCDLY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.26 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|