C13H17BrFNO3S — CID 107007701
5-bromo-2-fluoro-4-hept-6-enoxybenzenesulfonamide (PubChem CID 107007701) has the molecular formula C13H17BrFNO3S and a molecular weight of 366.25 g/mol. Its IUPAC name is 5-bromo-2-fluoro-4-hept-6-enoxybenzenesulfonamide.
| Compound Name | 5-bromo-2-fluoro-4-hept-6-enoxybenzenesulfonamide |
|---|---|
| PubChem CID | 107007701 |
| Molecular Formula | C13H17BrFNO3S |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | 5-bromo-2-fluoro-4-hept-6-enoxybenzenesulfonamide |
| SMILES | C=CCCCCCOc1cc(F)c(S(N)(=O)=O)cc1Br |
| InChI | InChI=1S/C13H17BrFNO3S/c1-2-3-4-5-6-7-19-12-9-11(15)13(8-10(12)14)20(16,17)18/h2,8-9H,1,3-7H2,(H2,16,17,18) |
| InChIKey | SJNHTQWSMZJVCA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|