C12H16BrFN2O4S — CID 82916643
5-bromo-2-fluoro-4-(2-morpholin-4-ylethoxy)benzenesulfonamide (PubChem CID 82916643) has the molecular formula C12H16BrFN2O4S and a molecular weight of 383.24 g/mol. Its IUPAC name is 5-bromo-2-fluoro-4-(2-morpholin-4-ylethoxy)benzenesulfonamide.
| Compound Name | 5-bromo-2-fluoro-4-(2-morpholin-4-ylethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 82916643 |
| Molecular Formula | C12H16BrFN2O4S |
| Molecular Weight | 383.24 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | 5-bromo-2-fluoro-4-(2-morpholin-4-ylethoxy)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(Br)c(OCCN2CCOCC2)cc1F |
| InChI | InChI=1S/C12H16BrFN2O4S/c13-9-7-12(21(15,17)18)10(14)8-11(9)20-6-3-16-1-4-19-5-2-16/h7-8H,1-6H2,(H2,15,17,18) |
| InChIKey | YDZIQMKXTPAEHA-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.24 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |