C15H11ClF3NO5S — CID 11315819
2-[2-(2-chloro-5-sulfamoylphenyl)-4-(trifluoromethyl)phenoxy]acetic acid (PubChem CID 11315819) has the molecular formula C15H11ClF3NO5S and a molecular weight of 409.77 g/mol. Its IUPAC name is 2-[2-(2-chloro-5-sulfamoylphenyl)-4-(trifluoromethyl)phenoxy]acetic acid.
| Compound Name | 2-[2-(2-chloro-5-sulfamoylphenyl)-4-(trifluoromethyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 11315819 |
| Molecular Formula | C15H11ClF3NO5S |
| Molecular Weight | 409.77 g/mol |
| Exact Mass | 409.00 |
| IUPAC Name | 2-[2-(2-chloro-5-sulfamoylphenyl)-4-(trifluoromethyl)phenoxy]acetic acid |
| SMILES | NS(=O)(=O)c1ccc(Cl)c(-c2cc(C(F)(F)F)ccc2OCC(=O)O)c1 |
| InChI | InChI=1S/C15H11ClF3NO5S/c16-12-3-2-9(26(20,23)24)6-10(12)11-5-8(15(17,18)19)1-4-13(11)25-7-14(21)22/h1-6H,7H2,(H,21,22)(H2,20,23,24) |
| InChIKey | AKJMJSFQGHRPDO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.77 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |