C17H12F3NO4 — CID 11210307
2-[2-(5-cyano-2-methoxyphenyl)-4-(trifluoromethyl)phenoxy]acetic acid (PubChem CID 11210307) has the molecular formula C17H12F3NO4 and a molecular weight of 351.28 g/mol. Its IUPAC name is 2-[2-(5-cyano-2-methoxyphenyl)-4-(trifluoromethyl)phenoxy]acetic acid.
| Compound Name | 2-[2-(5-cyano-2-methoxyphenyl)-4-(trifluoromethyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 11210307 |
| Molecular Formula | C17H12F3NO4 |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 2-[2-(5-cyano-2-methoxyphenyl)-4-(trifluoromethyl)phenoxy]acetic acid |
| SMILES | COc1ccc(C#N)cc1-c1cc(C(F)(F)F)ccc1OCC(=O)O |
| InChI | InChI=1S/C17H12F3NO4/c1-24-14-4-2-10(8-21)6-12(14)13-7-11(17(18,19)20)3-5-15(13)25-9-16(22)23/h2-7H,9H2,1H3,(H,22,23) |
| InChIKey | QZCCJJYAYCXVQE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |