C16H10F3NO3 — CID 54587655
2-[2-(3-cyanophenyl)-4-(trifluoromethyl)phenoxy]acetic acid (PubChem CID 54587655) has the molecular formula C16H10F3NO3 and a molecular weight of 321.25 g/mol. Its IUPAC name is 2-[2-(3-cyanophenyl)-4-(trifluoromethyl)phenoxy]acetic acid.
| Compound Name | 2-[2-(3-cyanophenyl)-4-(trifluoromethyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 54587655 |
| Molecular Formula | C16H10F3NO3 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 2-[2-(3-cyanophenyl)-4-(trifluoromethyl)phenoxy]acetic acid |
| SMILES | N#Cc1cccc(-c2cc(C(F)(F)F)ccc2OCC(=O)O)c1 |
| InChI | InChI=1S/C16H10F3NO3/c17-16(18,19)12-4-5-14(23-9-15(21)22)13(7-12)11-3-1-2-10(6-11)8-20/h1-7H,9H2,(H,21,22) |
| InChIKey | YQPVFQSSUIRJBC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |