About 3-oxohexanoic acid;3-(trifluoromethyl)benzonitrile
3-oxohexanoic acid;3-(trifluoromethyl)benzonitrile (PubChem CID 174930976) has the molecular formula C14H14F3NO3
and a molecular weight of 301.26 g/mol. Its IUPAC name is 3-oxohexanoic acid;3-(trifluoromethyl)benzonitrile.
Molecular Properties
| Compound Name | 3-oxohexanoic acid;3-(trifluoromethyl)benzonitrile |
| PubChem CID | 174930976 |
| Molecular Formula | C14H14F3NO3 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 3-oxohexanoic acid;3-(trifluoromethyl)benzonitrile |
| SMILES | CCCC(=O)CC(=O)O.N#Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H4F3N.C6H10O3/c9-8(10,11)7-3-1-2-6(4-7)5-12;1-2-3-5(7)4-6(8)9/h1-4H;2-4H2,1H3,(H,8,9) |
| InChIKey | YLBVYRILSKNKNX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-oxohexanoic acid;3-(trifluoromethyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxohexanoic acid;3-(trifluoromethyl)benzonitrile?
The IUPAC name of 3-oxohexanoic acid;3-(trifluoromethyl)benzonitrile (CID 174930976) is 3-oxohexanoic acid;3-(trifluoromethyl)benzonitrile.
What is the SMILES notation for 3-oxohexanoic acid;3-(trifluoromethyl)benzonitrile?
The canonical SMILES for 3-oxohexanoic acid;3-(trifluoromethyl)benzonitrile is CCCC(=O)CC(=O)O.N#Cc1cccc(C(F)(F)F)c1.
What is the InChIKey of 3-oxohexanoic acid;3-(trifluoromethyl)benzonitrile?
The InChIKey is YLBVYRILSKNKNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4F3N.C6H10O3/c9-8(10,11)7-3-1-2-6(4-7)5-12;1-2-3-5(7)4-6(8)9/h1-4H;2-4H2,1H3,(H,8,9).
What are the key properties of 3-oxohexanoic acid;3-(trifluoromethyl)benzonitrile?
3-oxohexanoic acid;3-(trifluoromethyl)benzonitrile has a molecular weight of 301.26 g/mol, XLogP of 3.41, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxohexanoic acid;3-(trifluoromethyl)benzonitrile is sourced from PubChem (CID 174930976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).