C16H18F3NO3 — CID 174930975
3-oxohexanoic acid;2,4,5-tris(fluoromethyl)benzonitrile (PubChem CID 174930975) has the molecular formula C16H18F3NO3 and a molecular weight of 329.32 g/mol. Its IUPAC name is 3-oxohexanoic acid;2,4,5-tris(fluoromethyl)benzonitrile.
| Compound Name | 3-oxohexanoic acid;2,4,5-tris(fluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 174930975 |
| Molecular Formula | C16H18F3NO3 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 3-oxohexanoic acid;2,4,5-tris(fluoromethyl)benzonitrile |
| SMILES | CCCC(=O)CC(=O)O.N#Cc1cc(CF)c(CF)cc1CF |
| InChI | InChI=1S/C10H8F3N.C6H10O3/c11-3-7-1-9(5-13)10(6-14)2-8(7)4-12;1-2-3-5(7)4-6(8)9/h1-2H,3-5H2;2-4H2,1H3,(H,8,9) |
| InChIKey | NFQZXLWWKRMXIM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|