C18H21ClF3NO3 — CID 174765497
3-chloro-2,4,5-tris(fluoromethyl)benzonitrile;ethyl 3-oxohexanoate (PubChem CID 174765497) has the molecular formula C18H21ClF3NO3 and a molecular weight of 391.82 g/mol. Its IUPAC name is 3-chloro-2,4,5-tris(fluoromethyl)benzonitrile;ethyl 3-oxohexanoate.
| Compound Name | 3-chloro-2,4,5-tris(fluoromethyl)benzonitrile;ethyl 3-oxohexanoate |
|---|---|
| PubChem CID | 174765497 |
| Molecular Formula | C18H21ClF3NO3 |
| Molecular Weight | 391.82 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 3-chloro-2,4,5-tris(fluoromethyl)benzonitrile;ethyl 3-oxohexanoate |
| SMILES | CCCC(=O)CC(=O)OCC.N#Cc1cc(CF)c(CF)c(Cl)c1CF |
| InChI | InChI=1S/C10H7ClF3N.C8H14O3/c11-10-8(3-13)6(2-12)1-7(5-15)9(10)4-14;1-3-5-7(9)6-8(10)11-4-2/h1H,2-4H2;3-6H2,1-2H3 |
| InChIKey | VWAKYGVQWQYYDT-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.82 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|