C15H14F3NO3 — CID 174309506
[3-cyano-2,5,6-tris(fluoromethyl)phenyl]methyl 3-oxobutanoate (PubChem CID 174309506) has the molecular formula C15H14F3NO3 and a molecular weight of 313.28 g/mol. Its IUPAC name is [3-cyano-2,5,6-tris(fluoromethyl)phenyl]methyl 3-oxobutanoate.
| Compound Name | [3-cyano-2,5,6-tris(fluoromethyl)phenyl]methyl 3-oxobutanoate |
|---|---|
| PubChem CID | 174309506 |
| Molecular Formula | C15H14F3NO3 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | [3-cyano-2,5,6-tris(fluoromethyl)phenyl]methyl 3-oxobutanoate |
| SMILES | CC(=O)CC(=O)OCc1c(CF)c(C#N)cc(CF)c1CF |
| InChI | InChI=1S/C15H14F3NO3/c1-9(20)2-15(21)22-8-14-12(5-17)10(4-16)3-11(7-19)13(14)6-18/h3H,2,4-6,8H2,1H3 |
| InChIKey | KQMMFNAKTKKVIL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|