About benzonitrile;ethyl 3-oxobutanoate
benzonitrile;ethyl 3-oxobutanoate (PubChem CID 174248493) has the molecular formula C13H15NO3
and a molecular weight of 233.27 g/mol. Its IUPAC name is benzonitrile;ethyl 3-oxobutanoate.
Molecular Properties
| Compound Name | benzonitrile;ethyl 3-oxobutanoate |
| PubChem CID | 174248493 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | benzonitrile;ethyl 3-oxobutanoate |
| SMILES | CCOC(=O)CC(C)=O.N#Cc1ccccc1 |
| InChI | InChI=1S/C7H5N.C6H10O3/c8-6-7-4-2-1-3-5-7;1-3-9-6(8)4-5(2)7/h1-5H;3-4H2,1-2H3 |
| InChIKey | PUEBIAUVZCAXAE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze benzonitrile;ethyl 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzonitrile;ethyl 3-oxobutanoate?
The IUPAC name of benzonitrile;ethyl 3-oxobutanoate (CID 174248493) is benzonitrile;ethyl 3-oxobutanoate.
What is the SMILES notation for benzonitrile;ethyl 3-oxobutanoate?
The canonical SMILES for benzonitrile;ethyl 3-oxobutanoate is CCOC(=O)CC(C)=O.N#Cc1ccccc1.
What is the InChIKey of benzonitrile;ethyl 3-oxobutanoate?
The InChIKey is PUEBIAUVZCAXAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N.C6H10O3/c8-6-7-4-2-1-3-5-7;1-3-9-6(8)4-5(2)7/h1-5H;3-4H2,1-2H3.
What are the key properties of benzonitrile;ethyl 3-oxobutanoate?
benzonitrile;ethyl 3-oxobutanoate has a molecular weight of 233.27 g/mol, XLogP of 2.09, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzonitrile;ethyl 3-oxobutanoate is sourced from PubChem (CID 174248493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).