C13H8ClF3O3S — CID 11515553
2-[2-(2-chlorothiophen-3-yl)-4-(trifluoromethyl)phenoxy]acetic acid (PubChem CID 11515553) has the molecular formula C13H8ClF3O3S and a molecular weight of 336.72 g/mol. Its IUPAC name is 2-[2-(2-chlorothiophen-3-yl)-4-(trifluoromethyl)phenoxy]acetic acid.
| Compound Name | 2-[2-(2-chlorothiophen-3-yl)-4-(trifluoromethyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 11515553 |
| Molecular Formula | C13H8ClF3O3S |
| Molecular Weight | 336.72 g/mol |
| Exact Mass | 335.98 |
| IUPAC Name | 2-[2-(2-chlorothiophen-3-yl)-4-(trifluoromethyl)phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(C(F)(F)F)cc1-c1ccsc1Cl |
| InChI | InChI=1S/C13H8ClF3O3S/c14-12-8(3-4-21-12)9-5-7(13(15,16)17)1-2-10(9)20-6-11(18)19/h1-5H,6H2,(H,18,19) |
| InChIKey | JXHQPQABCKJEQE-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.72 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |