C15H11ClF3NO3S — CID 142950719
2-[2-(5-aminosulfanyl-2-chlorophenyl)-4-(trifluoromethyl)phenoxy]acetic acid (PubChem CID 142950719) has the molecular formula C15H11ClF3NO3S and a molecular weight of 377.77 g/mol. Its IUPAC name is 2-[2-(5-aminosulfanyl-2-chlorophenyl)-4-(trifluoromethyl)phenoxy]acetic acid.
| Compound Name | 2-[2-(5-aminosulfanyl-2-chlorophenyl)-4-(trifluoromethyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 142950719 |
| Molecular Formula | C15H11ClF3NO3S |
| Molecular Weight | 377.77 g/mol |
| Exact Mass | 377.01 |
| IUPAC Name | 2-[2-(5-aminosulfanyl-2-chlorophenyl)-4-(trifluoromethyl)phenoxy]acetic acid |
| SMILES | NSc1ccc(Cl)c(-c2cc(C(F)(F)F)ccc2OCC(=O)O)c1 |
| InChI | InChI=1S/C15H11ClF3NO3S/c16-12-3-2-9(24-20)6-10(12)11-5-8(15(17,18)19)1-4-13(11)23-7-14(21)22/h1-6H,7,20H2,(H,21,22) |
| InChIKey | FMBITAUBLCSLCP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.77 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|