C17H12ClF3O4 — CID 143206756
2-[4-chloro-2-[3-methyl-5-(trifluoromethyl)benzoyl]phenoxy]acetic acid (PubChem CID 143206756) has the molecular formula C17H12ClF3O4 and a molecular weight of 372.73 g/mol. Its IUPAC name is 2-[4-chloro-2-[3-methyl-5-(trifluoromethyl)benzoyl]phenoxy]acetic acid.
| Compound Name | 2-[4-chloro-2-[3-methyl-5-(trifluoromethyl)benzoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 143206756 |
| Molecular Formula | C17H12ClF3O4 |
| Molecular Weight | 372.73 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 2-[4-chloro-2-[3-methyl-5-(trifluoromethyl)benzoyl]phenoxy]acetic acid |
| SMILES | Cc1cc(C(=O)c2cc(Cl)ccc2OCC(=O)O)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H12ClF3O4/c1-9-4-10(6-11(5-9)17(19,20)21)16(24)13-7-12(18)2-3-14(13)25-8-15(22)23/h2-7H,8H2,1H3,(H,22,23) |
| InChIKey | SSBIIPLIXMVGSW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.73 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |