C28H19Cl2F5N2O5 — CID 11721494
4-[3-chloro-4-[[2-[4-chloro-2-[3-fluoro-5-(trifluoromethyl)benzoyl]phenoxy]acetyl]amino]-2-fluorophenyl]-N-hydroxy-2,2-dimethylbut-3-ynamide (PubChem CID 11721494) has the molecular formula C28H19Cl2F5N2O5 and a molecular weight of 629.37 g/mol. Its IUPAC name is 4-[3-chloro-4-[[2-[4-chloro-2-[3-fluoro-5-(trifluoromethyl)benzoyl]phenoxy]acetyl]amino]-2-fluorophenyl]-N-hydroxy-2,2-dimethylbut-3-ynamide.
| Compound Name | 4-[3-chloro-4-[[2-[4-chloro-2-[3-fluoro-5-(trifluoromethyl)benzoyl]phenoxy]acetyl]amino]-2-fluorophenyl]-N-hydroxy-2,2-dimethylbut-3-ynamide |
|---|---|
| PubChem CID | 11721494 |
| Molecular Formula | C28H19Cl2F5N2O5 |
| Molecular Weight | 629.37 g/mol |
| Exact Mass | 628.06 |
| IUPAC Name | 4-[3-chloro-4-[[2-[4-chloro-2-[3-fluoro-5-(trifluoromethyl)benzoyl]phenoxy]acetyl]amino]-2-fluorophenyl]-N-hydroxy-2,2-dimethylbut-3-ynamide |
| SMILES | CC(C)(C#Cc1ccc(NC(=O)COc2ccc(Cl)cc2C(=O)c2cc(F)cc(C(F)(F)F)c2)c(Cl)c1F)C(=O)NO |
| InChI | InChI=1S/C28H19Cl2F5N2O5/c1-27(2,26(40)37-41)8-7-14-3-5-20(23(30)24(14)32)36-22(38)13-42-21-6-4-17(29)12-19(21)25(39)15-9-16(28(33,34)35)11-18(31)10-15/h3-6,9-12,41H,13H2,1-2H3,(H,36,38)(H,37,40) |
| InChIKey | WKLLMWXVDKFHTM-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.37 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|