C28H22ClF3N3O6S- — CID 23596848
(1E)-N-[4-[[2-[4-chloro-2-[3-cyano-5-(trifluoromethyl)benzoyl]phenoxy]acetyl]amino]-3-methylphenyl]sulfonyl-2-methylpropanimidate (PubChem CID 23596848) has the molecular formula C28H22ClF3N3O6S- and a molecular weight of 621.01 g/mol. Its IUPAC name is (1E)-N-[4-[[2-[4-chloro-2-[3-cyano-5-(trifluoromethyl)benzoyl]phenoxy]acetyl]amino]-3-methylphenyl]sulfonyl-2-methylpropanimidate.
| Compound Name | (1E)-N-[4-[[2-[4-chloro-2-[3-cyano-5-(trifluoromethyl)benzoyl]phenoxy]acetyl]amino]-3-methylphenyl]sulfonyl-2-methylpropanimidate |
|---|---|
| PubChem CID | 23596848 |
| Molecular Formula | C28H22ClF3N3O6S- |
| Molecular Weight | 621.01 g/mol |
| Exact Mass | 620.09 |
| IUPAC Name | (1E)-N-[4-[[2-[4-chloro-2-[3-cyano-5-(trifluoromethyl)benzoyl]phenoxy]acetyl]amino]-3-methylphenyl]sulfonyl-2-methylpropanimidate |
| SMILES | Cc1cc(S(=O)(=O)/N=C(/[O-])C(C)C)ccc1NC(=O)COc1ccc(Cl)cc1C(=O)c1cc(C#N)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H23ClF3N3O6S/c1-15(2)27(38)35-42(39,40)21-5-6-23(16(3)8-21)34-25(36)14-41-24-7-4-20(29)12-22(24)26(37)18-9-17(13-33)10-19(11-18)28(30,31)32/h4-12,15H,14H2,1-3H3,(H,34,36)(H,35,38)/p-1 |
| InChIKey | OAHFTSFEBLVYHZ-UHFFFAOYSA-M |
| XLogP | 4.89 |
| TPSA | 148.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.01 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|