C27H24ClN3O4S — CID 11656563
2-[4-chloro-2-(4-cyanobenzoyl)phenoxy]-N-[2-methyl-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]acetamide (PubChem CID 11656563) has the molecular formula C27H24ClN3O4S and a molecular weight of 522.03 g/mol. Its IUPAC name is 2-[4-chloro-2-(4-cyanobenzoyl)phenoxy]-N-[2-methyl-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]acetamide.
| Compound Name | 2-[4-chloro-2-(4-cyanobenzoyl)phenoxy]-N-[2-methyl-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 11656563 |
| Molecular Formula | C27H24ClN3O4S |
| Molecular Weight | 522.03 g/mol |
| Exact Mass | 521.12 |
| IUPAC Name | 2-[4-chloro-2-(4-cyanobenzoyl)phenoxy]-N-[2-methyl-4-(1-oxo-1,4-thiazinan-4-yl)phenyl]acetamide |
| SMILES | Cc1cc(N2CCS(=O)CC2)ccc1NC(=O)COc1ccc(Cl)cc1C(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C27H24ClN3O4S/c1-18-14-22(31-10-12-36(34)13-11-31)7-8-24(18)30-26(32)17-35-25-9-6-21(28)15-23(25)27(33)20-4-2-19(16-29)3-5-20/h2-9,14-15H,10-13,17H2,1H3,(H,30,32) |
| InChIKey | GMNONVIHLIPBPJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.03 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|