C27H28BrClN2O3S — CID 142047821
(4-bromophenyl)-(5-chloro-2-ethoxyphenyl)methanone;N-(2-methyl-4-thiomorpholin-4-ylphenyl)formamide (PubChem CID 142047821) has the molecular formula C27H28BrClN2O3S and a molecular weight of 575.96 g/mol. Its IUPAC name is (4-bromophenyl)-(5-chloro-2-ethoxyphenyl)methanone;N-(2-methyl-4-thiomorpholin-4-ylphenyl)formamide.
| Compound Name | (4-bromophenyl)-(5-chloro-2-ethoxyphenyl)methanone;N-(2-methyl-4-thiomorpholin-4-ylphenyl)formamide |
|---|---|
| PubChem CID | 142047821 |
| Molecular Formula | C27H28BrClN2O3S |
| Molecular Weight | 575.96 g/mol |
| Exact Mass | 574.07 |
| IUPAC Name | (4-bromophenyl)-(5-chloro-2-ethoxyphenyl)methanone;N-(2-methyl-4-thiomorpholin-4-ylphenyl)formamide |
| SMILES | CCOc1ccc(Cl)cc1C(=O)c1ccc(Br)cc1.Cc1cc(N2CCSCC2)ccc1NC=O |
| InChI | InChI=1S/C15H12BrClO2.C12H16N2OS/c1-2-19-14-8-7-12(17)9-13(14)15(18)10-3-5-11(16)6-4-10;1-10-8-11(2-3-12(10)13-9-15)14-4-6-16-7-5-14/h3-9H,2H2,1H3;2-3,8-9H,4-7H2,1H3,(H,13,15) |
| InChIKey | JLXXTTZWQIAYAO-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.96 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|