C23H31N3O3 — CID 36559277
3,4-diethoxy-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]benzamide (PubChem CID 36559277) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is 3,4-diethoxy-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]benzamide.
| Compound Name | 3,4-diethoxy-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 36559277 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 3,4-diethoxy-N-[2-methyl-4-(4-methylpiperazin-1-yl)phenyl]benzamide |
| SMILES | CCOc1ccc(C(=O)Nc2ccc(N3CCN(C)CC3)cc2C)cc1OCC |
| InChI | InChI=1S/C23H31N3O3/c1-5-28-21-10-7-18(16-22(21)29-6-2)23(27)24-20-9-8-19(15-17(20)3)26-13-11-25(4)12-14-26/h7-10,15-16H,5-6,11-14H2,1-4H3,(H,24,27) |
| InChIKey | WWCHMMAATLKRJM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|